C14H18ClNO2 — CID 114724598
1-amino-2-(5-chloro-1-benzofuran-2-yl)-3,3-dimethylbutan-2-ol (PubChem CID 114724598) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 1-amino-2-(5-chloro-1-benzofuran-2-yl)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-amino-2-(5-chloro-1-benzofuran-2-yl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114724598 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-amino-2-(5-chloro-1-benzofuran-2-yl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)(CN)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H18ClNO2/c1-13(2,3)14(17,8-16)12-7-9-6-10(15)4-5-11(9)18-12/h4-7,17H,8,16H2,1-3H3 |
| InChIKey | WCFORTFFNWAEFS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |