C14H17ClO2 — CID 114733752
4-(5-chloro-1-benzofuran-2-yl)-4-methylpentan-2-ol (PubChem CID 114733752) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 4-(5-chloro-1-benzofuran-2-yl)-4-methylpentan-2-ol.
| Compound Name | 4-(5-chloro-1-benzofuran-2-yl)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 114733752 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-(5-chloro-1-benzofuran-2-yl)-4-methylpentan-2-ol |
| SMILES | CC(O)CC(C)(C)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H17ClO2/c1-9(16)8-14(2,3)13-7-10-6-11(15)4-5-12(10)17-13/h4-7,9,16H,8H2,1-3H3 |
| InChIKey | ICOKVLIJQOSPTQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |