C16H12F3NO — CID 114728807
2-(2,4-difluorophenyl)-1-(7-fluoro-1-benzofuran-2-yl)ethanamine (PubChem CID 114728807) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(7-fluoro-1-benzofuran-2-yl)ethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-1-(7-fluoro-1-benzofuran-2-yl)ethanamine |
|---|---|
| PubChem CID | 114728807 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(7-fluoro-1-benzofuran-2-yl)ethanamine |
| SMILES | NC(Cc1ccc(F)cc1F)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C16H12F3NO/c17-11-5-4-9(13(19)8-11)6-14(20)15-7-10-2-1-3-12(18)16(10)21-15/h1-5,7-8,14H,6,20H2 |
| InChIKey | QNOLJMGHOHZSGT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |