C21H30O3 — CID 11472990
(1S,3S,5S,9S,10R,12R,14R)-3-(1,3-dioxolan-2-yl)-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one (PubChem CID 11472990) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (1S,3S,5S,9S,10R,12R,14R)-3-(1,3-dioxolan-2-yl)-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one.
| Compound Name | (1S,3S,5S,9S,10R,12R,14R)-3-(1,3-dioxolan-2-yl)-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one |
|---|---|
| PubChem CID | 11472990 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1S,3S,5S,9S,10R,12R,14R)-3-(1,3-dioxolan-2-yl)-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-6-en-15-one |
| SMILES | C[C@@H]1C[C@@H]2[C@H]([C@@H]3CC=C[C@@H]4C[C@H](C5OCCO5)C[C@]14C3=O)C2(C)C |
| InChI | InChI=1S/C21H30O3/c1-12-9-16-17(20(16,2)3)15-6-4-5-14-10-13(19-23-7-8-24-19)11-21(12,14)18(15)22/h4-5,12-17,19H,6-11H2,1-3H3/t12-,13+,14-,15+,16-,17+,21+/m1/s1 |
| InChIKey | HVVRZYNXLQBXMZ-IAYPEKGSSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|