C23H34O3 — CID 11187471
(1R,2S,2'S,4R,4'S,5R,7R)-4'-(1,3-dioxolan-2-yl)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one (PubChem CID 11187471) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (1R,2S,2'S,4R,4'S,5R,7R)-4'-(1,3-dioxolan-2-yl)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one.
| Compound Name | (1R,2S,2'S,4R,4'S,5R,7R)-4'-(1,3-dioxolan-2-yl)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 11187471 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (1R,2S,2'S,4R,4'S,5R,7R)-4'-(1,3-dioxolan-2-yl)-2'-ethenyl-5,8,8-trimethyl-2-prop-2-enylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one |
| SMILES | C=CC[C@@H]1C(=O)[C@]2(C[C@@H](C3OCCO3)C[C@H]2C=C)[C@H](C)C[C@@H]2[C@H]1C2(C)C |
| InChI | InChI=1S/C23H34O3/c1-6-8-17-19-18(22(19,4)5)11-14(3)23(20(17)24)13-15(12-16(23)7-2)21-25-9-10-26-21/h6-7,14-19,21H,1-2,8-13H2,3-5H3/t14-,15+,16-,17+,18-,19+,23-/m1/s1 |
| InChIKey | GSAKZTICVDTYNF-SPVBEPPHSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|