C15H18O2 — CID 114733767
2-methyl-3-(5-methyl-1-benzofuran-2-yl)cyclopentan-1-ol (PubChem CID 114733767) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-methyl-3-(5-methyl-1-benzofuran-2-yl)cyclopentan-1-ol.
| Compound Name | 2-methyl-3-(5-methyl-1-benzofuran-2-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 114733767 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-methyl-3-(5-methyl-1-benzofuran-2-yl)cyclopentan-1-ol |
| SMILES | Cc1ccc2oc(C3CCC(O)C3C)cc2c1 |
| InChI | InChI=1S/C15H18O2/c1-9-3-6-14-11(7-9)8-15(17-14)12-4-5-13(16)10(12)2/h3,6-8,10,12-13,16H,4-5H2,1-2H3 |
| InChIKey | BOFNPSCQMSODOU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |