C18H36N+ — CID 11473461
1-(2,7-dimethyloctyl)-1-prop-2-enylpiperidin-1-ium (PubChem CID 11473461) has the molecular formula C18H36N+ and a molecular weight of 266.49 g/mol. Its IUPAC name is 1-(2,7-dimethyloctyl)-1-prop-2-enylpiperidin-1-ium.
| Compound Name | 1-(2,7-dimethyloctyl)-1-prop-2-enylpiperidin-1-ium |
|---|---|
| PubChem CID | 11473461 |
| Molecular Formula | C18H36N+ |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.28 |
| IUPAC Name | 1-(2,7-dimethyloctyl)-1-prop-2-enylpiperidin-1-ium |
| SMILES | C=CC[N+]1(CC(C)CCCCC(C)C)CCCCC1 |
| InChI | InChI=1S/C18H36N/c1-5-13-19(14-9-6-10-15-19)16-18(4)12-8-7-11-17(2)3/h5,17-18H,1,6-16H2,2-4H3/q+1 |
| InChIKey | UIYNPNRSJAAUDO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|