C16H17FO3 — CID 114735394
2-(7-fluoro-1-benzofuran-2-yl)cycloheptane-1-carboxylic acid (PubChem CID 114735394) has the molecular formula C16H17FO3 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-(7-fluoro-1-benzofuran-2-yl)cycloheptane-1-carboxylic acid.
| Compound Name | 2-(7-fluoro-1-benzofuran-2-yl)cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 114735394 |
| Molecular Formula | C16H17FO3 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(7-fluoro-1-benzofuran-2-yl)cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCCC1c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C16H17FO3/c17-13-8-4-5-10-9-14(20-15(10)13)11-6-2-1-3-7-12(11)16(18)19/h4-5,8-9,11-12H,1-3,6-7H2,(H,18,19) |
| InChIKey | XMKQXEJQSRLPRR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |