C18H21NO2 — CID 114736885
1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl(1-benzofuran-2-yl)methanone (PubChem CID 114736885) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl(1-benzofuran-2-yl)methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl(1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 114736885 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl(1-benzofuran-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)C1CCC2CCCCC2N1 |
| InChI | InChI=1S/C18H21NO2/c20-18(17-11-13-6-2-4-8-16(13)21-17)15-10-9-12-5-1-3-7-14(12)19-15/h2,4,6,8,11-12,14-15,19H,1,3,5,7,9-10H2 |
| InChIKey | IUWIIUXUMLWKFE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |