C19H22O2 — CID 115807122
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(1-benzofuran-2-yl)methanone (PubChem CID 115807122) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(1-benzofuran-2-yl)methanone.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 115807122 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(1-benzofuran-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C19H22O2/c20-19(18-12-15-7-3-4-8-17(15)21-18)16-10-9-13-5-1-2-6-14(13)11-16/h3-4,7-8,12-14,16H,1-2,5-6,9-11H2 |
| InChIKey | FLADEMDYZCHNEP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |