C20H24O4S — CID 11473884
(5R)-5-hydroxy-1-(4-methoxyphenyl)-6-[(R)-(4-methylphenyl)sulfinyl]hexan-1-one (PubChem CID 11473884) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is (5R)-5-hydroxy-1-(4-methoxyphenyl)-6-[(R)-(4-methylphenyl)sulfinyl]hexan-1-one.
| Compound Name | (5R)-5-hydroxy-1-(4-methoxyphenyl)-6-[(R)-(4-methylphenyl)sulfinyl]hexan-1-one |
|---|---|
| PubChem CID | 11473884 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (5R)-5-hydroxy-1-(4-methoxyphenyl)-6-[(R)-(4-methylphenyl)sulfinyl]hexan-1-one |
| SMILES | COc1ccc(C(=O)CCC[C@@H](O)C[S@@](=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H24O4S/c1-15-6-12-19(13-7-15)25(23)14-17(21)4-3-5-20(22)16-8-10-18(24-2)11-9-16/h6-13,17,21H,3-5,14H2,1-2H3/t17-,25-/m1/s1 |
| InChIKey | WFCQKPAZZQRWOI-CRICUBBOSA-N |
| XLogP | 3.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |