About 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile
5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile (PubChem CID 11474302) has the molecular formula C16H12Cl2N6O
and a molecular weight of 375.22 g/mol. Its IUPAC name is 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile |
| PubChem CID | 11474302 |
| Molecular Formula | C16H12Cl2N6O |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(Cl)c1C(=O)n1nc(-c2ccccc2Cl)c(C#N)c1N |
| InChI | InChI=1S/C16H12Cl2N6O/c1-8-12(14(18)23(2)21-8)16(25)24-15(20)10(7-19)13(22-24)9-5-3-4-6-11(9)17/h3-6H,20H2,1-2H3 |
| InChIKey | PJKXSLZRPSONSW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile?
The IUPAC name of 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile (CID 11474302) is 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile.
What is the SMILES notation for 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile?
The canonical SMILES for 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile is Cc1nn(C)c(Cl)c1C(=O)n1nc(-c2ccccc2Cl)c(C#N)c1N.
What is the InChIKey of 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile?
The InChIKey is PJKXSLZRPSONSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N6O/c1-8-12(14(18)23(2)21-8)16(25)24-15(20)10(7-19)13(22-24)9-5-3-4-6-11(9)17/h3-6H,20H2,1-2H3.
What are the key properties of 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile?
5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile has a molecular weight of 375.22 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(5-chloro-1,3-dimethylpyrazole-4-carbonyl)-3-(2-chlorophenyl)pyrazole-4-carbonitrile is sourced from PubChem (CID 11474302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).