C22H44OSi2 — CID 11474488
trimethyl-[2-methylidene-4-[2-tri(propan-2-yl)silyloxyethynyl]heptyl]silane (PubChem CID 11474488) has the molecular formula C22H44OSi2 and a molecular weight of 380.77 g/mol. Its IUPAC name is trimethyl-[2-methylidene-4-[2-tri(propan-2-yl)silyloxyethynyl]heptyl]silane.
| Compound Name | trimethyl-[2-methylidene-4-[2-tri(propan-2-yl)silyloxyethynyl]heptyl]silane |
|---|---|
| PubChem CID | 11474488 |
| Molecular Formula | C22H44OSi2 |
| Molecular Weight | 380.77 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | trimethyl-[2-methylidene-4-[2-tri(propan-2-yl)silyloxyethynyl]heptyl]silane |
| SMILES | C=C(CC(C#CO[Si](C(C)C)(C(C)C)C(C)C)CCC)C[Si](C)(C)C |
| InChI | InChI=1S/C22H44OSi2/c1-12-13-22(16-21(8)17-24(9,10)11)14-15-23-25(18(2)3,19(4)5)20(6)7/h18-20,22H,8,12-13,16-17H2,1-7,9-11H3 |
| InChIKey | JWWJJNJHWQLGBS-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.77 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|