C20H38OSi2 — CID 10617884
triethyl-[5-(2-trimethylsilylethynyl)nona-1,8-dien-5-yloxy]silane (PubChem CID 10617884) has the molecular formula C20H38OSi2 and a molecular weight of 350.70 g/mol. Its IUPAC name is triethyl-[5-(2-trimethylsilylethynyl)nona-1,8-dien-5-yloxy]silane.
| Compound Name | triethyl-[5-(2-trimethylsilylethynyl)nona-1,8-dien-5-yloxy]silane |
|---|---|
| PubChem CID | 10617884 |
| Molecular Formula | C20H38OSi2 |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | triethyl-[5-(2-trimethylsilylethynyl)nona-1,8-dien-5-yloxy]silane |
| SMILES | C=CCCC(C#C[Si](C)(C)C)(CCC=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H38OSi2/c1-9-14-16-20(17-15-10-2,18-19-22(6,7)8)21-23(11-3,12-4)13-5/h9-10H,1-2,11-17H2,3-8H3 |
| InChIKey | FJBASCWQWXTSED-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|