C19H34OSi — CID 11748805
triethyl(5-prop-1-ynyldeca-1,9-dien-5-yloxy)silane (PubChem CID 11748805) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is triethyl(5-prop-1-ynyldeca-1,9-dien-5-yloxy)silane.
| Compound Name | triethyl(5-prop-1-ynyldeca-1,9-dien-5-yloxy)silane |
|---|---|
| PubChem CID | 11748805 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | triethyl(5-prop-1-ynyldeca-1,9-dien-5-yloxy)silane |
| SMILES | C=CCCCC(C#CC)(CCC=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H34OSi/c1-7-13-15-18-19(16-9-3,17-14-8-2)20-21(10-4,11-5)12-6/h7-8H,1-2,10-15,17-18H2,3-6H3 |
| InChIKey | DUAGAZDNBRXNLB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|