C22H40OSi — CID 11405343
[3-methyl-3-(2-methylprop-2-enyl)oct-7-en-1-ynoxy]-tri(propan-2-yl)silane (PubChem CID 11405343) has the molecular formula C22H40OSi and a molecular weight of 348.65 g/mol. Its IUPAC name is [3-methyl-3-(2-methylprop-2-enyl)oct-7-en-1-ynoxy]-tri(propan-2-yl)silane.
| Compound Name | [3-methyl-3-(2-methylprop-2-enyl)oct-7-en-1-ynoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11405343 |
| Molecular Formula | C22H40OSi |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | [3-methyl-3-(2-methylprop-2-enyl)oct-7-en-1-ynoxy]-tri(propan-2-yl)silane |
| SMILES | C=CCCCC(C)(C#CO[Si](C(C)C)(C(C)C)C(C)C)CC(=C)C |
| InChI | InChI=1S/C22H40OSi/c1-11-12-13-14-22(10,17-18(2)3)15-16-23-24(19(4)5,20(6)7)21(8)9/h11,19-21H,1-2,12-14,17H2,3-10H3 |
| InChIKey | QZVPGBSJJZXXIB-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|