C20H36OSi — CID 11141761
triethyl-(2-methyl-5-prop-1-ynyldeca-1,9-dien-5-yl)oxysilane (PubChem CID 11141761) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is triethyl-(2-methyl-5-prop-1-ynyldeca-1,9-dien-5-yl)oxysilane.
| Compound Name | triethyl-(2-methyl-5-prop-1-ynyldeca-1,9-dien-5-yl)oxysilane |
|---|---|
| PubChem CID | 11141761 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | triethyl-(2-methyl-5-prop-1-ynyldeca-1,9-dien-5-yl)oxysilane |
| SMILES | C=CCCCC(C#CC)(CCC(=C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H36OSi/c1-8-13-14-17-20(16-9-2,18-15-19(6)7)21-22(10-3,11-4)12-5/h8H,1,6,10-15,17-18H2,2-5,7H3 |
| InChIKey | PGBAMCQKHDUJKN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|