C17H25N5O2SSi — CID 11474814
2-piperazin-1-yl-N-[5-[(E)-2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 11474814) has the molecular formula C17H25N5O2SSi and a molecular weight of 391.57 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-[5-[(E)-2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-piperazin-1-yl-N-[5-[(E)-2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 11474814 |
| Molecular Formula | C17H25N5O2SSi |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-piperazin-1-yl-N-[5-[(E)-2-(5-trimethylsilyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | C[Si](C)(C)c1cnc(/C=C/c2cnc(NC(=O)CN3CCNCC3)s2)o1 |
| InChI | InChI=1S/C17H25N5O2SSi/c1-26(2,3)16-11-19-15(24-16)5-4-13-10-20-17(25-13)21-14(23)12-22-8-6-18-7-9-22/h4-5,10-11,18H,6-9,12H2,1-3H3,(H,20,21,23)/b5-4+ |
| InChIKey | JZJJUHZKPSEWQM-SNAWJCMRSA-N |
| XLogP | 1.69 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|