About ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate
ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate (PubChem CID 114748150) has the molecular formula C13H18O3S
and a molecular weight of 254.35 g/mol. Its IUPAC name is ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate.
Analyze ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate?
The IUPAC name of ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate (CID 114748150) is ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate.
What is the SMILES notation for ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate?
The canonical SMILES for ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate is CCOC(=O)c1csc2c1C(C)(C)OC2(C)C.
What is the InChIKey of ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate?
The InChIKey is INMXKAYOVDIGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3S/c1-6-15-11(14)8-7-17-10-9(8)12(2,3)16-13(10,4)5/h7H,6H2,1-5H3.
What are the key properties of ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate?
ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate has a molecular weight of 254.35 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4,4,6,6-tetramethylthieno[2,3-c]furan-3-carboxylate is sourced from PubChem (CID 114748150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).