C14H17BrFNO3 — CID 114751339
2-(2-bromo-4-fluorophenoxy)-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide (PubChem CID 114751339) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide |
|---|---|
| PubChem CID | 114751339 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide |
| SMILES | O=C(COc1ccc(F)cc1Br)NCC1(CCO)CC1 |
| InChI | InChI=1S/C14H17BrFNO3/c15-11-7-10(16)1-2-12(11)20-8-13(19)17-9-14(3-4-14)5-6-18/h1-2,7,18H,3-6,8-9H2,(H,17,19) |
| InChIKey | SRVOIGYUVSOEIJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |