C14H17BrFNO4 — CID 107301912
2-(2-bromo-4-fluorophenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide (PubChem CID 107301912) has the molecular formula C14H17BrFNO4 and a molecular weight of 362.20 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 107301912 |
| Molecular Formula | C14H17BrFNO4 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide |
| SMILES | CC1OCCC1(O)CNC(=O)COc1ccc(F)cc1Br |
| InChI | InChI=1S/C14H17BrFNO4/c1-9-14(19,4-5-20-9)8-17-13(18)7-21-12-3-2-10(16)6-11(12)15/h2-3,6,9,19H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | HWGNURUAFZAPEP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |