C15H20ClNO4 — CID 107301810
2-(2-chloro-5-methylphenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide (PubChem CID 107301810) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 107301810 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]acetamide |
| SMILES | Cc1ccc(Cl)c(OCC(=O)NCC2(O)CCOC2C)c1 |
| InChI | InChI=1S/C15H20ClNO4/c1-10-3-4-12(16)13(7-10)21-8-14(18)17-9-15(19)5-6-20-11(15)2/h3-4,7,11,19H,5-6,8-9H2,1-2H3,(H,17,18) |
| InChIKey | XVAPNYPJWDGWAN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |