C15H21BrFNO3 — CID 103725719
2-(2-bromo-4-fluorophenoxy)-N-[2-(2-hydroxyethyl)pentyl]acetamide (PubChem CID 103725719) has the molecular formula C15H21BrFNO3 and a molecular weight of 362.24 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[2-(2-hydroxyethyl)pentyl]acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[2-(2-hydroxyethyl)pentyl]acetamide |
|---|---|
| PubChem CID | 103725719 |
| Molecular Formula | C15H21BrFNO3 |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[2-(2-hydroxyethyl)pentyl]acetamide |
| SMILES | CCCC(CCO)CNC(=O)COc1ccc(F)cc1Br |
| InChI | InChI=1S/C15H21BrFNO3/c1-2-3-11(6-7-19)9-18-15(20)10-21-14-5-4-12(17)8-13(14)16/h4-5,8,11,19H,2-3,6-7,9-10H2,1H3,(H,18,20) |
| InChIKey | PRXGBINTXPDSHL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |