C18H19BrClFN2O2 — CID 42890728
2-(2-bromo-4-fluorophenoxy)-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]acetamide (PubChem CID 42890728) has the molecular formula C18H19BrClFN2O2 and a molecular weight of 429.72 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 42890728 |
| Molecular Formula | C18H19BrClFN2O2 |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]acetamide |
| SMILES | CN(C)C(CNC(=O)COc1ccc(F)cc1Br)c1ccccc1Cl |
| InChI | InChI=1S/C18H19BrClFN2O2/c1-23(2)16(13-5-3-4-6-15(13)20)10-22-18(24)11-25-17-8-7-12(21)9-14(17)19/h3-9,16H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | CENNOSCRNMMDKQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |