C18H24N2 — CID 114755354
3-methyl-1-(4-methylquinolin-2-yl)-N-propylbut-3-en-1-amine (PubChem CID 114755354) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-methyl-1-(4-methylquinolin-2-yl)-N-propylbut-3-en-1-amine.
| Compound Name | 3-methyl-1-(4-methylquinolin-2-yl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 114755354 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3-methyl-1-(4-methylquinolin-2-yl)-N-propylbut-3-en-1-amine |
| SMILES | C=C(C)CC(NCCC)c1cc(C)c2ccccc2n1 |
| InChI | InChI=1S/C18H24N2/c1-5-10-19-17(11-13(2)3)18-12-14(4)15-8-6-7-9-16(15)20-18/h6-9,12,17,19H,2,5,10-11H2,1,3-4H3 |
| InChIKey | HGFZHQUFAMAIAS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|