C19H26N2 — CID 114755324
1-(4-methylquinolin-2-yl)-N-propylhex-5-en-1-amine (PubChem CID 114755324) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(4-methylquinolin-2-yl)-N-propylhex-5-en-1-amine.
| Compound Name | 1-(4-methylquinolin-2-yl)-N-propylhex-5-en-1-amine |
|---|---|
| PubChem CID | 114755324 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(4-methylquinolin-2-yl)-N-propylhex-5-en-1-amine |
| SMILES | C=CCCCC(NCCC)c1cc(C)c2ccccc2n1 |
| InChI | InChI=1S/C19H26N2/c1-4-6-7-12-18(20-13-5-2)19-14-15(3)16-10-8-9-11-17(16)21-19/h4,8-11,14,18,20H,1,5-7,12-13H2,2-3H3 |
| InChIKey | QJAMSZBXKFMHHE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|