C22H20N4O3S — CID 11475654
4-[[4-(2-hydroxyethyl)-3-oxoquinoxalin-2-yl]amino]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 11475654) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-[[4-(2-hydroxyethyl)-3-oxoquinoxalin-2-yl]amino]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-[[4-(2-hydroxyethyl)-3-oxoquinoxalin-2-yl]amino]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 11475654 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-[[4-(2-hydroxyethyl)-3-oxoquinoxalin-2-yl]amino]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccs1)c1ccc(Nc2nc3ccccc3n(CCO)c2=O)cc1 |
| InChI | InChI=1S/C22H20N4O3S/c27-12-11-26-19-6-2-1-5-18(19)25-20(22(26)29)24-16-9-7-15(8-10-16)21(28)23-14-17-4-3-13-30-17/h1-10,13,27H,11-12,14H2,(H,23,28)(H,24,25) |
| InChIKey | YWEODAWUFFOIME-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |