C20H16N4O2S — CID 11303405
4-[(4-methyl-3-oxoquinoxalin-2-yl)amino]-N-thiophen-2-ylbenzamide (PubChem CID 11303405) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is 4-[(4-methyl-3-oxoquinoxalin-2-yl)amino]-N-thiophen-2-ylbenzamide.
| Compound Name | 4-[(4-methyl-3-oxoquinoxalin-2-yl)amino]-N-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 11303405 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 4-[(4-methyl-3-oxoquinoxalin-2-yl)amino]-N-thiophen-2-ylbenzamide |
| SMILES | Cn1c(=O)c(Nc2ccc(C(=O)Nc3cccs3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C20H16N4O2S/c1-24-16-6-3-2-5-15(16)22-18(20(24)26)21-14-10-8-13(9-11-14)19(25)23-17-7-4-12-27-17/h2-12H,1H3,(H,21,22)(H,23,25) |
| InChIKey | JTSJUBCXGDNOBZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |