C13H18ClN3 — CID 114757776
N-[[1-(2-chloroethyl)cyclopropyl]methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 114757776) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-[[1-(2-chloroethyl)cyclopropyl]methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114757776 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | ClCCC1(CNc2ncnc3c2CCC3)CC1 |
| InChI | InChI=1S/C13H18ClN3/c14-7-6-13(4-5-13)8-15-12-10-2-1-3-11(10)16-9-17-12/h9H,1-8H2,(H,15,16,17) |
| InChIKey | BDPNULKQISBREW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|