C8H9N3O2 — CID 114763744
3-(1-ethylpyrazol-4-yl)-4H-1,2-oxazol-5-one (PubChem CID 114763744) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 3-(1-ethylpyrazol-4-yl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(1-ethylpyrazol-4-yl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 114763744 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 3-(1-ethylpyrazol-4-yl)-4H-1,2-oxazol-5-one |
| SMILES | CCn1cc(C2=NOC(=O)C2)cn1 |
| InChI | InChI=1S/C8H9N3O2/c1-2-11-5-6(4-9-11)7-3-8(12)13-10-7/h4-5H,2-3H2,1H3 |
| InChIKey | FUUSAXMELJZNPY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|