C29H28N2O3 — CID 11476505
3-(1-benzoylpiperidin-3-yl)-6-methoxy-2-methyl-4-phenylisoquinolin-1-one (PubChem CID 11476505) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(1-benzoylpiperidin-3-yl)-6-methoxy-2-methyl-4-phenylisoquinolin-1-one.
| Compound Name | 3-(1-benzoylpiperidin-3-yl)-6-methoxy-2-methyl-4-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 11476505 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-(1-benzoylpiperidin-3-yl)-6-methoxy-2-methyl-4-phenylisoquinolin-1-one |
| SMILES | COc1ccc2c(=O)n(C)c(C3CCCN(C(=O)c4ccccc4)C3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C29H28N2O3/c1-30-27(22-14-9-17-31(19-22)28(32)21-12-7-4-8-13-21)26(20-10-5-3-6-11-20)25-18-23(34-2)15-16-24(25)29(30)33/h3-8,10-13,15-16,18,22H,9,14,17,19H2,1-2H3 |
| InChIKey | YJOYBBDAPCAMHZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |