C14H20N4O — CID 114770138
2-methyl-6-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-4-carboxamide (PubChem CID 114770138) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-methyl-6-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2-methyl-6-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114770138 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-methyl-6-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-4-carboxamide |
| SMILES | Cc1cc(C(N)=O)cc(N2CC3CNCC3C2C)n1 |
| InChI | InChI=1S/C14H20N4O/c1-8-3-10(14(15)19)4-13(17-8)18-7-11-5-16-6-12(11)9(18)2/h3-4,9,11-12,16H,5-7H2,1-2H3,(H2,15,19) |
| InChIKey | KAHSTOUTUFMFNG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |