C7H2F3NO3S — CID 114770559
2,4,6-trifluoro-N-(oxomethylidene)benzenesulfonamide (PubChem CID 114770559) has the molecular formula C7H2F3NO3S and a molecular weight of 237.16 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-(oxomethylidene)benzenesulfonamide.
| Compound Name | 2,4,6-trifluoro-N-(oxomethylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 114770559 |
| Molecular Formula | C7H2F3NO3S |
| Molecular Weight | 237.16 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | 2,4,6-trifluoro-N-(oxomethylidene)benzenesulfonamide |
| SMILES | O=C=NS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C7H2F3NO3S/c8-4-1-5(9)7(6(10)2-4)15(13,14)11-3-12/h1-2H |
| InChIKey | WSILJAGWZKRBSH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|