C7H3ClIN3O — CID 114771551
2-(5-chloro-2-pyridinyl)-5-iodo-1,3,4-oxadiazole (PubChem CID 114771551) has the molecular formula C7H3ClIN3O and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(5-chloro-2-pyridinyl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771551 |
| Molecular Formula | C7H3ClIN3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 306.90 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-5-iodo-1,3,4-oxadiazole |
| SMILES | Clc1ccc(-c2nnc(I)o2)nc1 |
| InChI | InChI=1S/C7H3ClIN3O/c8-4-1-2-5(10-3-4)6-11-12-7(9)13-6/h1-3H |
| InChIKey | GVXNQYBBULBDLX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|