C5H2IN3OS — CID 114771755
2-iodo-5-(1,3-thiazol-4-yl)-1,3,4-oxadiazole (PubChem CID 114771755) has the molecular formula C5H2IN3OS and a molecular weight of 279.06 g/mol. Its IUPAC name is 2-iodo-5-(1,3-thiazol-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-iodo-5-(1,3-thiazol-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771755 |
| Molecular Formula | C5H2IN3OS |
| Molecular Weight | 279.06 g/mol |
| Exact Mass | 278.90 |
| IUPAC Name | 2-iodo-5-(1,3-thiazol-4-yl)-1,3,4-oxadiazole |
| SMILES | Ic1nnc(-c2cscn2)o1 |
| InChI | InChI=1S/C5H2IN3OS/c6-5-9-8-4(10-5)3-1-11-2-7-3/h1-2H |
| InChIKey | LWAQOJQXIMHACQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.06 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|