C9H7NS — CID 101141064
4-(2,6-dideuteriophenyl)-1,3-thiazole (PubChem CID 101141064) has the molecular formula C9H7NS and a molecular weight of 163.24 g/mol. Its IUPAC name is 4-(2,6-dideuteriophenyl)-1,3-thiazole.
| Compound Name | 4-(2,6-dideuteriophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 101141064 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 4-(2,6-dideuteriophenyl)-1,3-thiazole |
| SMILES | [2H]c1cccc([2H])c1-c1cscn1 |
| InChI | InChI=1S/C9H7NS/c1-2-4-8(5-3-1)9-6-11-7-10-9/h1-7H/i4D,5D |
| InChIKey | KXCQDIWJQBSUJF-KFRNQKGQSA-N |
| XLogP | 2.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |