C7H6N2S — CID 118537050
4-(1H-pyrrol-3-yl)-1,3-thiazole (PubChem CID 118537050) has the molecular formula C7H6N2S and a molecular weight of 150.21 g/mol. Its IUPAC name is 4-(1H-pyrrol-3-yl)-1,3-thiazole.
| Compound Name | 4-(1H-pyrrol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 118537050 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4-(1H-pyrrol-3-yl)-1,3-thiazole |
| SMILES | c1cc(-c2cscn2)c[nH]1 |
| InChI | InChI=1S/C7H6N2S/c1-2-8-3-6(1)7-4-10-5-9-7/h1-5,8H |
| InChIKey | WXVOWZMMISSPDP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |