C12H15BrO4S — CID 114772397
3-bromo-4-[(3-methoxyphenyl)methoxy]thiolane 1,1-dioxide (PubChem CID 114772397) has the molecular formula C12H15BrO4S and a molecular weight of 335.22 g/mol. Its IUPAC name is 3-bromo-4-[(3-methoxyphenyl)methoxy]thiolane 1,1-dioxide.
| Compound Name | 3-bromo-4-[(3-methoxyphenyl)methoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 114772397 |
| Molecular Formula | C12H15BrO4S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 3-bromo-4-[(3-methoxyphenyl)methoxy]thiolane 1,1-dioxide |
| SMILES | COc1cccc(COC2CS(=O)(=O)CC2Br)c1 |
| InChI | InChI=1S/C12H15BrO4S/c1-16-10-4-2-3-9(5-10)6-17-12-8-18(14,15)7-11(12)13/h2-5,11-12H,6-8H2,1H3 |
| InChIKey | QRPLPTABMKJUKL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|