C18H27IO — CID 114773330
1-[2-iodo-1-(3,3,5-trimethylcyclohexyl)oxyethyl]-4-methylbenzene (PubChem CID 114773330) has the molecular formula C18H27IO and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-[2-iodo-1-(3,3,5-trimethylcyclohexyl)oxyethyl]-4-methylbenzene.
| Compound Name | 1-[2-iodo-1-(3,3,5-trimethylcyclohexyl)oxyethyl]-4-methylbenzene |
|---|---|
| PubChem CID | 114773330 |
| Molecular Formula | C18H27IO |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[2-iodo-1-(3,3,5-trimethylcyclohexyl)oxyethyl]-4-methylbenzene |
| SMILES | Cc1ccc(C(CI)OC2CC(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H27IO/c1-13-5-7-15(8-6-13)17(12-19)20-16-9-14(2)10-18(3,4)11-16/h5-8,14,16-17H,9-12H2,1-4H3 |
| InChIKey | NDULWRKBERGIFB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|