C18H24ClIO — CID 114774676
2-[1-(2-chlorophenyl)-2-iodoethoxy]-1,7,7-trimethylbicyclo[2.2.1]heptane (PubChem CID 114774676) has the molecular formula C18H24ClIO and a molecular weight of 418.75 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-2-iodoethoxy]-1,7,7-trimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-[1-(2-chlorophenyl)-2-iodoethoxy]-1,7,7-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 114774676 |
| Molecular Formula | C18H24ClIO |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-2-iodoethoxy]-1,7,7-trimethylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)C2CCC1(C)C(OC(CI)c1ccccc1Cl)C2 |
| InChI | InChI=1S/C18H24ClIO/c1-17(2)12-8-9-18(17,3)16(10-12)21-15(11-20)13-6-4-5-7-14(13)19/h4-7,12,15-16H,8-11H2,1-3H3 |
| InChIKey | MRNNSOPYGACSHX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|