C15H20BrIO — CID 114774884
1-bromo-3-[[1-(iodomethyl)-4-methylcyclohexyl]oxymethyl]benzene (PubChem CID 114774884) has the molecular formula C15H20BrIO and a molecular weight of 423.13 g/mol. Its IUPAC name is 1-bromo-3-[[1-(iodomethyl)-4-methylcyclohexyl]oxymethyl]benzene.
| Compound Name | 1-bromo-3-[[1-(iodomethyl)-4-methylcyclohexyl]oxymethyl]benzene |
|---|---|
| PubChem CID | 114774884 |
| Molecular Formula | C15H20BrIO |
| Molecular Weight | 423.13 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 1-bromo-3-[[1-(iodomethyl)-4-methylcyclohexyl]oxymethyl]benzene |
| SMILES | CC1CCC(CI)(OCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H20BrIO/c1-12-5-7-15(11-17,8-6-12)18-10-13-3-2-4-14(16)9-13/h2-4,9,12H,5-8,10-11H2,1H3 |
| InChIKey | SWKALUWKWVIIJZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.13 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|