C15H27IO — CID 114775186
1-(4,4-dimethylcyclohexyl)oxy-2-iodocycloheptane (PubChem CID 114775186) has the molecular formula C15H27IO and a molecular weight of 350.28 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)oxy-2-iodocycloheptane.
| Compound Name | 1-(4,4-dimethylcyclohexyl)oxy-2-iodocycloheptane |
|---|---|
| PubChem CID | 114775186 |
| Molecular Formula | C15H27IO |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)oxy-2-iodocycloheptane |
| SMILES | CC1(C)CCC(OC2CCCCCC2I)CC1 |
| InChI | InChI=1S/C15H27IO/c1-15(2)10-8-12(9-11-15)17-14-7-5-3-4-6-13(14)16/h12-14H,3-11H2,1-2H3 |
| InChIKey | LZHLQEHHPRJVPR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|