C13H23ClO2 — CID 114342820
4-(3-chloro-2-methoxycyclobutyl)oxy-1,1-dimethylcyclohexane (PubChem CID 114342820) has the molecular formula C13H23ClO2 and a molecular weight of 246.78 g/mol. Its IUPAC name is 4-(3-chloro-2-methoxycyclobutyl)oxy-1,1-dimethylcyclohexane.
| Compound Name | 4-(3-chloro-2-methoxycyclobutyl)oxy-1,1-dimethylcyclohexane |
|---|---|
| PubChem CID | 114342820 |
| Molecular Formula | C13H23ClO2 |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-(3-chloro-2-methoxycyclobutyl)oxy-1,1-dimethylcyclohexane |
| SMILES | COC1C(Cl)CC1OC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H23ClO2/c1-13(2)6-4-9(5-7-13)16-11-8-10(14)12(11)15-3/h9-12H,4-8H2,1-3H3 |
| InChIKey | NOEPTNUELCARJW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|