C14H27NO — CID 114340866
2-(4,4-dimethylcyclohexyl)oxycyclohexan-1-amine (PubChem CID 114340866) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexyl)oxycyclohexan-1-amine.
| Compound Name | 2-(4,4-dimethylcyclohexyl)oxycyclohexan-1-amine |
|---|---|
| PubChem CID | 114340866 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2-(4,4-dimethylcyclohexyl)oxycyclohexan-1-amine |
| SMILES | CC1(C)CCC(OC2CCCCC2N)CC1 |
| InChI | InChI=1S/C14H27NO/c1-14(2)9-7-11(8-10-14)16-13-6-4-3-5-12(13)15/h11-13H,3-10,15H2,1-2H3 |
| InChIKey | PODFSSALSBTONZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |