C20H28BrNO5S2 — CID 11477655
ethyl (Z)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanyl-4-(4-methylpyridin-1-ium-1-yl)-5-methylsulfanyl-3-oxopent-4-enoate bromide (PubChem CID 11477655) has the molecular formula C20H28BrNO5S2 and a molecular weight of 506.48 g/mol. Its IUPAC name is ethyl (Z)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanyl-4-(4-methylpyridin-1-ium-1-yl)-5-methylsulfanyl-3-oxopent-4-enoate bromide.
| Compound Name | ethyl (Z)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanyl-4-(4-methylpyridin-1-ium-1-yl)-5-methylsulfanyl-3-oxopent-4-enoate bromide |
|---|---|
| PubChem CID | 11477655 |
| Molecular Formula | C20H28BrNO5S2 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | ethyl (Z)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]sulfanyl-4-(4-methylpyridin-1-ium-1-yl)-5-methylsulfanyl-3-oxopent-4-enoate bromide |
| SMILES | CCOC(=O)CC(=O)/C(=C(\SC)SCC(=O)OC(C)(C)C)[n+]1ccc(C)cc1.[Br-] |
| InChI | InChI=1S/C20H28NO5S2.BrH/c1-7-25-16(23)12-15(22)18(21-10-8-14(2)9-11-21)19(27-6)28-13-17(24)26-20(3,4)5;/h8-11H,7,12-13H2,1-6H3;1H/q+1;/p-1/b19-18-; |
| InChIKey | OZBVTYBHUKPKJE-TVWXOORISA-M |
| XLogP | 0.37 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|