C21H28O7 — CID 178171667
1-O-tert-butyl 2-O,3-O-diethyl (Z)-1-phenylmethoxyprop-1-ene-1,2,3-tricarboxylate (PubChem CID 178171667) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,3-O-diethyl (Z)-1-phenylmethoxyprop-1-ene-1,2,3-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,3-O-diethyl (Z)-1-phenylmethoxyprop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 178171667 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-O-tert-butyl 2-O,3-O-diethyl (Z)-1-phenylmethoxyprop-1-ene-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C/C(C(=O)OCC)=C(/OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28O7/c1-6-25-17(22)13-16(19(23)26-7-2)18(20(24)28-21(3,4)5)27-14-15-11-9-8-10-12-15/h8-12H,6-7,13-14H2,1-5H3/b18-16- |
| InChIKey | IRONBYMPNKDKNO-VLGSPTGOSA-N |
| XLogP | 3.32 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|