C8H16N2O2S — CID 114776562
6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbothioamide (PubChem CID 114776562) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbothioamide.
| Compound Name | 6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 114776562 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbothioamide |
| SMILES | CC1(C)CN(C(N)=S)CC(CO)O1 |
| InChI | InChI=1S/C8H16N2O2S/c1-8(2)5-10(7(9)13)3-6(4-11)12-8/h6,11H,3-5H2,1-2H3,(H2,9,13) |
| InChIKey | KZPDVPCDKKFGOI-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|