C13H25N3O4 — CID 104969920
N'-hydroxy-2-[6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbonyl]-3-methylbutanimidamide (PubChem CID 104969920) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is N'-hydroxy-2-[6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbonyl]-3-methylbutanimidamide.
| Compound Name | N'-hydroxy-2-[6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbonyl]-3-methylbutanimidamide |
|---|---|
| PubChem CID | 104969920 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | N'-hydroxy-2-[6-(hydroxymethyl)-2,2-dimethylmorpholine-4-carbonyl]-3-methylbutanimidamide |
| SMILES | CC(C)C(C(=O)N1CC(CO)OC(C)(C)C1)C(N)=NO |
| InChI | InChI=1S/C13H25N3O4/c1-8(2)10(11(14)15-19)12(18)16-5-9(6-17)20-13(3,4)7-16/h8-10,17,19H,5-7H2,1-4H3,(H2,14,15) |
| InChIKey | GYWTWYJVSBBQRH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|