C10H19BrFNO — CID 114780804
6-(bromomethyl)-4-(3-fluoropropyl)-2,2-dimethylmorpholine (PubChem CID 114780804) has the molecular formula C10H19BrFNO and a molecular weight of 268.17 g/mol. Its IUPAC name is 6-(bromomethyl)-4-(3-fluoropropyl)-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-(3-fluoropropyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114780804 |
| Molecular Formula | C10H19BrFNO |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 6-(bromomethyl)-4-(3-fluoropropyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(CCCF)CC(CBr)O1 |
| InChI | InChI=1S/C10H19BrFNO/c1-10(2)8-13(5-3-4-12)7-9(6-11)14-10/h9H,3-8H2,1-2H3 |
| InChIKey | OBEMSOABDUIYQK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|