C14H22ClN3O2 — CID 114781110
[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone (PubChem CID 114781110) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone.
| Compound Name | [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 114781110 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C)c1C(=O)N1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C14H22ClN3O2/c1-9-12(10(2)17(5)16-9)13(19)18-7-11(6-15)20-14(3,4)8-18/h11H,6-8H2,1-5H3 |
| InChIKey | HGACZRNTUAERTD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|